C10H19N3O5S — CID 63149485
1-[2-(methanesulfonamido)ethylcarbamoyl]-3-methylpyrrolidine-3-carboxylic acid (PubChem CID 63149485) has the molecular formula C10H19N3O5S and a molecular weight of 293.35 g/mol. Its IUPAC name is 1-[2-(methanesulfonamido)ethylcarbamoyl]-3-methylpyrrolidine-3-carboxylic acid.
| Compound Name | 1-[2-(methanesulfonamido)ethylcarbamoyl]-3-methylpyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 63149485 |
| Molecular Formula | C10H19N3O5S |
| Molecular Weight | 293.35 g/mol |
| Exact Mass | 293.10 |
| IUPAC Name | 1-[2-(methanesulfonamido)ethylcarbamoyl]-3-methylpyrrolidine-3-carboxylic acid |
| SMILES | CC1(C(=O)O)CCN(C(=O)NCCNS(C)(=O)=O)C1 |
| InChI | InChI=1S/C10H19N3O5S/c1-10(8(14)15)3-6-13(7-10)9(16)11-4-5-12-19(2,17)18/h12H,3-7H2,1-2H3,(H,11,16)(H,14,15) |
| InChIKey | CPQZAQUQUYZABV-UHFFFAOYSA-N |
| XLogP | -0.96 |
| TPSA | 115.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.35 |
| LogP ≤ 5 | -0.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|