3-methylpyrrolidine-1,3-dicarboxylic acid

C7H11NO4 — CID 23111893

IUPAC3-methylpyrrolidine-1,3-dicarboxylic acid
SMILESCC1(C(=O)O)CCN(C(=O)O)C1
InChIInChI=1S/C7H11NO4/c1-7(5(9)10)2-3-8(4-7)6(11)12/h2-4H2,1H3,(H,9,10)(H,11,12)
InChIKeyAYYSIQXKSVIMNE-UHFFFAOYSA-N
MW173.17 g/mol
LogP0.46
Rot. Bonds1

About 3-methylpyrrolidine-1,3-dicarboxylic acid

3-methylpyrrolidine-1,3-dicarboxylic acid (PubChem CID 23111893) has the molecular formula C7H11NO4 and a molecular weight of 173.17 g/mol. Its IUPAC name is 3-methylpyrrolidine-1,3-dicarboxylic acid.

Molecular Properties

Compound Name3-methylpyrrolidine-1,3-dicarboxylic acid
PubChem CID23111893
Molecular FormulaC7H11NO4
Molecular Weight173.17 g/mol
Exact Mass173.07
IUPAC Name3-methylpyrrolidine-1,3-dicarboxylic acid
SMILESCC1(C(=O)O)CCN(C(=O)O)C1
InChIInChI=1S/C7H11NO4/c1-7(5(9)10)2-3-8(4-7)6(11)12/h2-4H2,1H3,(H,9,10)(H,11,12)
InChIKeyAYYSIQXKSVIMNE-UHFFFAOYSA-N
XLogP0.46
TPSA77.84 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds1
Heavy Atoms12
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500173.17
LogP ≤ 50.46
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze 3-methylpyrrolidine-1,3-dicarboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-methylpyrrolidine-1,3-dicarboxylic acid?
The IUPAC name of 3-methylpyrrolidine-1,3-dicarboxylic acid (CID 23111893) is 3-methylpyrrolidine-1,3-dicarboxylic acid.
What is the SMILES notation for 3-methylpyrrolidine-1,3-dicarboxylic acid?
The canonical SMILES for 3-methylpyrrolidine-1,3-dicarboxylic acid is CC1(C(=O)O)CCN(C(=O)O)C1.
What is the InChIKey of 3-methylpyrrolidine-1,3-dicarboxylic acid?
The InChIKey is AYYSIQXKSVIMNE-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11NO4/c1-7(5(9)10)2-3-8(4-7)6(11)12/h2-4H2,1H3,(H,9,10)(H,11,12).
What are the key properties of 3-methylpyrrolidine-1,3-dicarboxylic acid?
3-methylpyrrolidine-1,3-dicarboxylic acid has a molecular weight of 173.17 g/mol, XLogP of 0.46, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methylpyrrolidine-1,3-dicarboxylic acid is sourced from PubChem (CID 23111893), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).