C17H22N8O7S — CID 135213719
[7-(dimethylcarbamoyl)-3-[(1,2-dimethylpyrazol-1-ium-3-yl)carbamoyl]-5-methyl-9-oxo-4,5,8,10-tetrazatricyclo[6.2.1.02,6]undeca-2(6),3-dien-10-yl] sulfate (PubChem CID 135213719) has the molecular formula C17H22N8O7S and a molecular weight of 482.48 g/mol. Its IUPAC name is [7-(dimethylcarbamoyl)-3-[(1,2-dimethylpyrazol-1-ium-3-yl)carbamoyl]-5-methyl-9-oxo-4,5,8,10-tetrazatricyclo[6.2.1.02,6]undeca-2(6),3-dien-10-yl] sulfate.
| Compound Name | [7-(dimethylcarbamoyl)-3-[(1,2-dimethylpyrazol-1-ium-3-yl)carbamoyl]-5-methyl-9-oxo-4,5,8,10-tetrazatricyclo[6.2.1.02,6]undeca-2(6),3-dien-10-yl] sulfate |
|---|---|
| PubChem CID | 135213719 |
| Molecular Formula | C17H22N8O7S |
| Molecular Weight | 482.48 g/mol |
| Exact Mass | 482.13 |
| IUPAC Name | [7-(dimethylcarbamoyl)-3-[(1,2-dimethylpyrazol-1-ium-3-yl)carbamoyl]-5-methyl-9-oxo-4,5,8,10-tetrazatricyclo[6.2.1.02,6]undeca-2(6),3-dien-10-yl] sulfate |
| SMILES | CN(C)C(=O)C1c2c(c(C(=O)Nc3cc[n+](C)n3C)nn2C)C2CN1C(=O)N2OS(=O)(=O)[O-] |
| InChI | InChI=1S/C17H22N8O7S/c1-20(2)16(27)14-13-11(9-8-24(14)17(28)25(9)32-33(29,30)31)12(19-22(13)4)15(26)18-10-6-7-21(3)23(10)5/h6-7,9,14H,8H2,1-5H3,(H,29,30,31) |
| InChIKey | NHDCHWNOWVRGJE-UHFFFAOYSA-N |
| XLogP | -1.85 |
| TPSA | 166.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.48 |
| LogP ≤ 5 | -1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|