C12H13N3O7S — CID 69346182
[(1S,8R)-10-oxo-11-sulfooxy-9,11-diazatricyclo[7.2.1.02,7]dodeca-2,4,6-trien-8-yl]methyl carbamate (PubChem CID 69346182) has the molecular formula C12H13N3O7S and a molecular weight of 343.32 g/mol. Its IUPAC name is [(1S,8R)-10-oxo-11-sulfooxy-9,11-diazatricyclo[7.2.1.02,7]dodeca-2,4,6-trien-8-yl]methyl carbamate.
| Compound Name | [(1S,8R)-10-oxo-11-sulfooxy-9,11-diazatricyclo[7.2.1.02,7]dodeca-2,4,6-trien-8-yl]methyl carbamate |
|---|---|
| PubChem CID | 69346182 |
| Molecular Formula | C12H13N3O7S |
| Molecular Weight | 343.32 g/mol |
| Exact Mass | 343.05 |
| IUPAC Name | [(1S,8R)-10-oxo-11-sulfooxy-9,11-diazatricyclo[7.2.1.02,7]dodeca-2,4,6-trien-8-yl]methyl carbamate |
| SMILES | NC(=O)OC[C@H]1c2ccccc2[C@H]2CN1C(=O)N2OS(=O)(=O)O |
| InChI | InChI=1S/C12H13N3O7S/c13-11(16)21-6-10-8-4-2-1-3-7(8)9-5-14(10)12(17)15(9)22-23(18,19)20/h1-4,9-10H,5-6H2,(H2,13,16)(H,18,19,20)/t9-,10+/m1/s1 |
| InChIKey | FWGPKQOPVHXEDL-ZJUUUORDSA-N |
| XLogP | 0.35 |
| TPSA | 139.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.32 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|