C9H13N3NaO7S — CID 172717444
CID 172717444 (PubChem CID 172717444) has the molecular formula C9H13N3NaO7S and a molecular weight of 330.27 g/mol.
| Compound Name | CID 172717444 |
|---|---|
| PubChem CID | 172717444 |
| Molecular Formula | C9H13N3NaO7S |
| Molecular Weight | 330.27 g/mol |
| Exact Mass | 330.04 |
| IUPAC Name | — |
| SMILES | COC[C@@H]1C=C(C(N)=O)[C@@H]2CN1C(=O)N2OS(=O)(=O)O.[Na] |
| InChI | InChI=1S/C9H13N3O7S.Na/c1-18-4-5-2-6(8(10)13)7-3-11(5)9(14)12(7)19-20(15,16)17;/h2,5,7H,3-4H2,1H3,(H2,10,13)(H,15,16,17);/t5-,7-;/m0./s1 |
| InChIKey | GBBRDYKDFGIGKQ-KQBMADMWSA-N |
| XLogP | -2.11 |
| TPSA | 139.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.27 |
| LogP ≤ 5 | -2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|