C10H15N3O7S — CID 134363401
[(2S,5R,6S,8R)-5-(methoxymethyl)-3,10-dioxo-1,4,9-triazatricyclo[6.2.1.02,6]undecan-9-yl] hydrogen sulfate (PubChem CID 134363401) has the molecular formula C10H15N3O7S and a molecular weight of 321.31 g/mol. Its IUPAC name is [(2S,5R,6S,8R)-5-(methoxymethyl)-3,10-dioxo-1,4,9-triazatricyclo[6.2.1.02,6]undecan-9-yl] hydrogen sulfate.
| Compound Name | [(2S,5R,6S,8R)-5-(methoxymethyl)-3,10-dioxo-1,4,9-triazatricyclo[6.2.1.02,6]undecan-9-yl] hydrogen sulfate |
|---|---|
| PubChem CID | 134363401 |
| Molecular Formula | C10H15N3O7S |
| Molecular Weight | 321.31 g/mol |
| Exact Mass | 321.06 |
| IUPAC Name | [(2S,5R,6S,8R)-5-(methoxymethyl)-3,10-dioxo-1,4,9-triazatricyclo[6.2.1.02,6]undecan-9-yl] hydrogen sulfate |
| SMILES | COC[C@@H]1NC(=O)[C@@H]2[C@H]1C[C@@H]1CN2C(=O)N1OS(=O)(=O)O |
| InChI | InChI=1S/C10H15N3O7S/c1-19-4-7-6-2-5-3-12(8(6)9(14)11-7)10(15)13(5)20-21(16,17)18/h5-8H,2-4H2,1H3,(H,11,14)(H,16,17,18)/t5-,6+,7+,8+/m1/s1 |
| InChIKey | YOBKBJHPPXSOOC-KVPKETBZSA-N |
| XLogP | -1.64 |
| TPSA | 125.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.31 |
| LogP ≤ 5 | -1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|