C20H28N6O10S — CID 134363400
bis[(2S,5R,6S,8R)-5-(methoxymethyl)-3,10-dioxo-1,4,9-triazatricyclo[6.2.1.02,6]undecan-9-yl] sulfate (PubChem CID 134363400) has the molecular formula C20H28N6O10S and a molecular weight of 544.54 g/mol. Its IUPAC name is bis[(2S,5R,6S,8R)-5-(methoxymethyl)-3,10-dioxo-1,4,9-triazatricyclo[6.2.1.02,6]undecan-9-yl] sulfate.
| Compound Name | bis[(2S,5R,6S,8R)-5-(methoxymethyl)-3,10-dioxo-1,4,9-triazatricyclo[6.2.1.02,6]undecan-9-yl] sulfate |
|---|---|
| PubChem CID | 134363400 |
| Molecular Formula | C20H28N6O10S |
| Molecular Weight | 544.54 g/mol |
| Exact Mass | 544.16 |
| IUPAC Name | bis[(2S,5R,6S,8R)-5-(methoxymethyl)-3,10-dioxo-1,4,9-triazatricyclo[6.2.1.02,6]undecan-9-yl] sulfate |
| SMILES | COC[C@@H]1NC(=O)[C@@H]2[C@H]1C[C@@H]1CN2C(=O)N1OS(=O)(=O)ON1C(=O)N2C[C@H]1C[C@H]1[C@H](COC)NC(=O)[C@H]12 |
| InChI | InChI=1S/C20H28N6O10S/c1-33-7-13-11-3-9-5-23(15(11)17(27)21-13)19(29)25(9)35-37(31,32)36-26-10-4-12-14(8-34-2)22-18(28)16(12)24(6-10)20(26)30/h9-16H,3-8H2,1-2H3,(H,21,27)(H,22,28)/t9-,10-,11+,12+,13+,14+,15+,16+/m1/s1 |
| InChIKey | QXYWNVZQXXSPSG-XGBCULGOSA-N |
| XLogP | -2.63 |
| TPSA | 176.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.54 |
| LogP ≤ 5 | -2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |