C6H8N2O7S — CID 66965371
(4S)-2-oxo-3-sulfooxy-1,3-diazabicyclo[2.2.1]heptane-6-carboxylic acid (PubChem CID 66965371) has the molecular formula C6H8N2O7S and a molecular weight of 252.20 g/mol. Its IUPAC name is (4S)-2-oxo-3-sulfooxy-1,3-diazabicyclo[2.2.1]heptane-6-carboxylic acid.
| Compound Name | (4S)-2-oxo-3-sulfooxy-1,3-diazabicyclo[2.2.1]heptane-6-carboxylic acid |
|---|---|
| PubChem CID | 66965371 |
| Molecular Formula | C6H8N2O7S |
| Molecular Weight | 252.20 g/mol |
| Exact Mass | 252.01 |
| IUPAC Name | (4S)-2-oxo-3-sulfooxy-1,3-diazabicyclo[2.2.1]heptane-6-carboxylic acid |
| SMILES | O=C(O)C1C[C@H]2CN1C(=O)N2OS(=O)(=O)O |
| InChI | InChI=1S/C6H8N2O7S/c9-5(10)4-1-3-2-7(4)6(11)8(3)15-16(12,13)14/h3-4H,1-2H2,(H,9,10)(H,12,13,14)/t3-,4?/m0/s1 |
| InChIKey | SUKSTYNHYSIQTC-WUCPZUCCSA-N |
| XLogP | -1.32 |
| TPSA | 124.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.20 |
| LogP ≤ 5 | -1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|