C9H12N2O4 — CID 66965684
(4R,6S)-2-oxo-3-prop-2-enoxy-1,3-diazabicyclo[2.2.1]heptane-6-carboxylic acid (PubChem CID 66965684) has the molecular formula C9H12N2O4 and a molecular weight of 212.20 g/mol. Its IUPAC name is (4R,6S)-2-oxo-3-prop-2-enoxy-1,3-diazabicyclo[2.2.1]heptane-6-carboxylic acid.
| Compound Name | (4R,6S)-2-oxo-3-prop-2-enoxy-1,3-diazabicyclo[2.2.1]heptane-6-carboxylic acid |
|---|---|
| PubChem CID | 66965684 |
| Molecular Formula | C9H12N2O4 |
| Molecular Weight | 212.20 g/mol |
| Exact Mass | 212.08 |
| IUPAC Name | (4R,6S)-2-oxo-3-prop-2-enoxy-1,3-diazabicyclo[2.2.1]heptane-6-carboxylic acid |
| SMILES | C=CCON1C(=O)N2C[C@H]1C[C@H]2C(=O)O |
| InChI | InChI=1S/C9H12N2O4/c1-2-3-15-11-6-4-7(8(12)13)10(5-6)9(11)14/h2,6-7H,1,3-5H2,(H,12,13)/t6-,7+/m1/s1 |
| InChIKey | IXNJLVZCVDCEFA-RQJHMYQMSA-N |
| XLogP | 0.07 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.20 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|