C10H14N2O3 — CID 123867900
2-(hydroxymethyl)-6-prop-2-enoxy-1,6-diazabicyclo[3.2.1]oct-3-en-7-one (PubChem CID 123867900) has the molecular formula C10H14N2O3 and a molecular weight of 210.23 g/mol. Its IUPAC name is 2-(hydroxymethyl)-6-prop-2-enoxy-1,6-diazabicyclo[3.2.1]oct-3-en-7-one.
| Compound Name | 2-(hydroxymethyl)-6-prop-2-enoxy-1,6-diazabicyclo[3.2.1]oct-3-en-7-one |
|---|---|
| PubChem CID | 123867900 |
| Molecular Formula | C10H14N2O3 |
| Molecular Weight | 210.23 g/mol |
| Exact Mass | 210.10 |
| IUPAC Name | 2-(hydroxymethyl)-6-prop-2-enoxy-1,6-diazabicyclo[3.2.1]oct-3-en-7-one |
| SMILES | C=CCON1C(=O)N2CC1C=CC2CO |
| InChI | InChI=1S/C10H14N2O3/c1-2-5-15-12-8-3-4-9(7-13)11(6-8)10(12)14/h2-4,8-9,13H,1,5-7H2 |
| InChIKey | UQKZFOKYZLNIHM-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 53.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.23 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|