C10H13IN2O3 — CID 122590183
(2S,5S)-2-(hydroxymethyl)-4-iodo-6-prop-2-enoxy-1,6-diazabicyclo[3.2.1]oct-3-en-7-one (PubChem CID 122590183) has the molecular formula C10H13IN2O3 and a molecular weight of 336.13 g/mol. Its IUPAC name is (2S,5S)-2-(hydroxymethyl)-4-iodo-6-prop-2-enoxy-1,6-diazabicyclo[3.2.1]oct-3-en-7-one.
| Compound Name | (2S,5S)-2-(hydroxymethyl)-4-iodo-6-prop-2-enoxy-1,6-diazabicyclo[3.2.1]oct-3-en-7-one |
|---|---|
| PubChem CID | 122590183 |
| Molecular Formula | C10H13IN2O3 |
| Molecular Weight | 336.13 g/mol |
| Exact Mass | 336.00 |
| IUPAC Name | (2S,5S)-2-(hydroxymethyl)-4-iodo-6-prop-2-enoxy-1,6-diazabicyclo[3.2.1]oct-3-en-7-one |
| SMILES | C=CCON1C(=O)N2C[C@H]1C(I)=C[C@H]2CO |
| InChI | InChI=1S/C10H13IN2O3/c1-2-3-16-13-9-5-12(10(13)15)7(6-14)4-8(9)11/h2,4,7,9,14H,1,3,5-6H2/t7-,9-/m0/s1 |
| InChIKey | AVMFIRANRVTNKH-CBAPKCEASA-N |
| XLogP | 0.90 |
| TPSA | 53.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.13 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|