C8H12N2O6S — CID 134371607
[(2R,5S)-2-ethyl-4,7-dioxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate (PubChem CID 134371607) has the molecular formula C8H12N2O6S and a molecular weight of 264.26 g/mol. Its IUPAC name is [(2R,5S)-2-ethyl-4,7-dioxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate.
| Compound Name | [(2R,5S)-2-ethyl-4,7-dioxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate |
|---|---|
| PubChem CID | 134371607 |
| Molecular Formula | C8H12N2O6S |
| Molecular Weight | 264.26 g/mol |
| Exact Mass | 264.04 |
| IUPAC Name | [(2R,5S)-2-ethyl-4,7-dioxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate |
| SMILES | CC[C@@H]1CC(=O)[C@@H]2CN1C(=O)N2OS(=O)(=O)O |
| InChI | InChI=1S/C8H12N2O6S/c1-2-5-3-7(11)6-4-9(5)8(12)10(6)16-17(13,14)15/h5-6H,2-4H2,1H3,(H,13,14,15)/t5-,6+/m1/s1 |
| InChIKey | HHWKWWSMFQLLNE-RITPCOANSA-N |
| XLogP | -0.42 |
| TPSA | 104.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.26 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|