C18H24N6O8S — CID 142767177
bis(2-carbamoyl-3,4-dimethyl-7-oxo-1,6-diazabicyclo[3.2.1]oct-3-en-6-yl) sulfate (PubChem CID 142767177) has the molecular formula C18H24N6O8S and a molecular weight of 484.49 g/mol. Its IUPAC name is bis(2-carbamoyl-3,4-dimethyl-7-oxo-1,6-diazabicyclo[3.2.1]oct-3-en-6-yl) sulfate.
| Compound Name | bis(2-carbamoyl-3,4-dimethyl-7-oxo-1,6-diazabicyclo[3.2.1]oct-3-en-6-yl) sulfate |
|---|---|
| PubChem CID | 142767177 |
| Molecular Formula | C18H24N6O8S |
| Molecular Weight | 484.49 g/mol |
| Exact Mass | 484.14 |
| IUPAC Name | bis(2-carbamoyl-3,4-dimethyl-7-oxo-1,6-diazabicyclo[3.2.1]oct-3-en-6-yl) sulfate |
| SMILES | CC1=C(C)C2CN(C(=O)N2OS(=O)(=O)ON2C(=O)N3CC2C(C)=C(C)C3C(N)=O)C1C(N)=O |
| InChI | InChI=1S/C18H24N6O8S/c1-7-9(3)13(15(19)25)21-5-11(7)23(17(21)27)31-33(29,30)32-24-12-6-22(18(24)28)14(16(20)26)10(4)8(12)2/h11-14H,5-6H2,1-4H3,(H2,19,25)(H2,20,26) |
| InChIKey | PFLXVGDJEFHRRI-UHFFFAOYSA-N |
| XLogP | -1.29 |
| TPSA | 185.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.49 |
| LogP ≤ 5 | -1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|