C16H16N6O6S — CID 142767170
bis(2-cyano-4-methyl-7-oxo-1,6-diazabicyclo[3.2.1]oct-3-en-6-yl) sulfate (PubChem CID 142767170) has the molecular formula C16H16N6O6S and a molecular weight of 420.41 g/mol. Its IUPAC name is bis(2-cyano-4-methyl-7-oxo-1,6-diazabicyclo[3.2.1]oct-3-en-6-yl) sulfate.
| Compound Name | bis(2-cyano-4-methyl-7-oxo-1,6-diazabicyclo[3.2.1]oct-3-en-6-yl) sulfate |
|---|---|
| PubChem CID | 142767170 |
| Molecular Formula | C16H16N6O6S |
| Molecular Weight | 420.41 g/mol |
| Exact Mass | 420.09 |
| IUPAC Name | bis(2-cyano-4-methyl-7-oxo-1,6-diazabicyclo[3.2.1]oct-3-en-6-yl) sulfate |
| SMILES | CC1=CC(C#N)N2CC1N(OS(=O)(=O)ON1C(=O)N3CC1C(C)=CC3C#N)C2=O |
| InChI | InChI=1S/C16H16N6O6S/c1-9-3-11(5-17)19-7-13(9)21(15(19)23)27-29(25,26)28-22-14-8-20(16(22)24)12(6-18)4-10(14)2/h3-4,11-14H,7-8H2,1-2H3 |
| InChIKey | UWHIIFJHOYHMGD-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 147.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.41 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|