C36H43N4O8PS — CID 140709751
tert-butyl N-[2-[[(2S,5R)-4-methyl-7-oxo-6-[triphenyl-[(E)-prop-1-enyl]-λ5-phosphanyl]oxysulfonyloxy-1,6-diazabicyclo[3.2.1]oct-3-ene-2-carbonyl]amino]ethyl]carbamate (PubChem CID 140709751) has the molecular formula C36H43N4O8PS and a molecular weight of 722.80 g/mol. Its IUPAC name is tert-butyl N-[2-[[(2S,5R)-4-methyl-7-oxo-6-[triphenyl-[(E)-prop-1-enyl]-λ5-phosphanyl]oxysulfonyloxy-1,6-diazabicyclo[3.2.1]oct-3-ene-2-carbonyl]amino]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[[(2S,5R)-4-methyl-7-oxo-6-[triphenyl-[(E)-prop-1-enyl]-λ5-phosphanyl]oxysulfonyloxy-1,6-diazabicyclo[3.2.1]oct-3-ene-2-carbonyl]amino]ethyl]carbamate |
|---|---|
| PubChem CID | 140709751 |
| Molecular Formula | C36H43N4O8PS |
| Molecular Weight | 722.80 g/mol |
| Exact Mass | 722.25 |
| IUPAC Name | tert-butyl N-[2-[[(2S,5R)-4-methyl-7-oxo-6-[triphenyl-[(E)-prop-1-enyl]-λ5-phosphanyl]oxysulfonyloxy-1,6-diazabicyclo[3.2.1]oct-3-ene-2-carbonyl]amino]ethyl]carbamate |
| SMILES | C/C=C/P(OS(=O)(=O)ON1C(=O)N2C[C@H]1C(C)=C[C@H]2C(=O)NCCNC(=O)OC(C)(C)C)(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C36H43N4O8PS/c1-6-24-49(28-16-10-7-11-17-28,29-18-12-8-13-19-29,30-20-14-9-15-21-30)48-50(44,45)47-40-32-26-39(35(40)43)31(25-27(32)2)33(41)37-22-23-38-34(42)46-36(3,4)5/h6-21,24-25,31-32H,22-23,26H2,1-5H3,(H,37,41)(H,38,42)/b24-6+/t31-,32-/m0/s1 |
| InChIKey | FZSHJBLVHBJECV-YNSGAMQXSA-N |
| XLogP | 4.23 |
| TPSA | 143.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 50 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 722.80 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|