C22H29N5O5 — CID 140548231
tert-butyl N-[2-[(1S,7S)-7-(hydroxymethyl)-9-oxo-10-phenylmethoxy-4,5,8,10-tetrazatricyclo[6.2.1.02,6]undeca-2,5-dien-4-yl]ethyl]carbamate (PubChem CID 140548231) has the molecular formula C22H29N5O5 and a molecular weight of 443.50 g/mol. Its IUPAC name is tert-butyl N-[2-[(1S,7S)-7-(hydroxymethyl)-9-oxo-10-phenylmethoxy-4,5,8,10-tetrazatricyclo[6.2.1.02,6]undeca-2,5-dien-4-yl]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[(1S,7S)-7-(hydroxymethyl)-9-oxo-10-phenylmethoxy-4,5,8,10-tetrazatricyclo[6.2.1.02,6]undeca-2,5-dien-4-yl]ethyl]carbamate |
|---|---|
| PubChem CID | 140548231 |
| Molecular Formula | C22H29N5O5 |
| Molecular Weight | 443.50 g/mol |
| Exact Mass | 443.22 |
| IUPAC Name | tert-butyl N-[2-[(1S,7S)-7-(hydroxymethyl)-9-oxo-10-phenylmethoxy-4,5,8,10-tetrazatricyclo[6.2.1.02,6]undeca-2,5-dien-4-yl]ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCn1cc2c(n1)[C@@H](CO)N1C[C@H]2N(OCc2ccccc2)C1=O |
| InChI | InChI=1S/C22H29N5O5/c1-22(2,3)32-20(29)23-9-10-25-11-16-17-12-26(18(13-28)19(16)24-25)21(30)27(17)31-14-15-7-5-4-6-8-15/h4-8,11,17-18,28H,9-10,12-14H2,1-3H3,(H,23,29)/t17-,18-/m1/s1 |
| InChIKey | BSBQLMUCJMYCJW-QZTJIDSGSA-N |
| XLogP | 2.37 |
| TPSA | 109.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.50 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |