C9H12N3NaO7S — CID 71767738
sodium [(2S,5S)-2-carbamoyl-4-(methoxymethyl)-7-oxo-1,6-diazabicyclo[3.2.1]oct-3-en-6-yl] sulfate (PubChem CID 71767738) has the molecular formula C9H12N3NaO7S and a molecular weight of 329.27 g/mol. Its IUPAC name is sodium [(2S,5S)-2-carbamoyl-4-(methoxymethyl)-7-oxo-1,6-diazabicyclo[3.2.1]oct-3-en-6-yl] sulfate.
| Compound Name | sodium [(2S,5S)-2-carbamoyl-4-(methoxymethyl)-7-oxo-1,6-diazabicyclo[3.2.1]oct-3-en-6-yl] sulfate |
|---|---|
| PubChem CID | 71767738 |
| Molecular Formula | C9H12N3NaO7S |
| Molecular Weight | 329.27 g/mol |
| Exact Mass | 329.03 |
| IUPAC Name | sodium [(2S,5S)-2-carbamoyl-4-(methoxymethyl)-7-oxo-1,6-diazabicyclo[3.2.1]oct-3-en-6-yl] sulfate |
| SMILES | COCC1=C[C@@H](C(N)=O)N2C[C@H]1N(OS(=O)(=O)[O-])C2=O.[Na+] |
| InChI | InChI=1S/C9H13N3O7S.Na/c1-18-4-5-2-6(8(10)13)11-3-7(5)12(9(11)14)19-20(15,16)17;/h2,6-7H,3-4H2,1H3,(H2,10,13)(H,15,16,17);/q;+1/p-1/t6-,7+;/m0./s1 |
| InChIKey | BAVYGGPLJLJCAL-UOERWJHTSA-M |
| XLogP | -5.07 |
| TPSA | 142.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.27 |
| LogP ≤ 5 | -5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|