C8H10N3NaO7S — CID 71767896
sodium [(2S,5S)-4-carbamoyl-2-(hydroxymethyl)-7-oxo-1,6-diazabicyclo[3.2.1]oct-3-en-6-yl] sulfate (PubChem CID 71767896) has the molecular formula C8H10N3NaO7S and a molecular weight of 315.24 g/mol. Its IUPAC name is sodium [(2S,5S)-4-carbamoyl-2-(hydroxymethyl)-7-oxo-1,6-diazabicyclo[3.2.1]oct-3-en-6-yl] sulfate.
| Compound Name | sodium [(2S,5S)-4-carbamoyl-2-(hydroxymethyl)-7-oxo-1,6-diazabicyclo[3.2.1]oct-3-en-6-yl] sulfate |
|---|---|
| PubChem CID | 71767896 |
| Molecular Formula | C8H10N3NaO7S |
| Molecular Weight | 315.24 g/mol |
| Exact Mass | 315.01 |
| IUPAC Name | sodium [(2S,5S)-4-carbamoyl-2-(hydroxymethyl)-7-oxo-1,6-diazabicyclo[3.2.1]oct-3-en-6-yl] sulfate |
| SMILES | NC(=O)C1=C[C@@H](CO)N2C[C@H]1N(OS(=O)(=O)[O-])C2=O.[Na+] |
| InChI | InChI=1S/C8H11N3O7S.Na/c9-7(13)5-1-4(3-12)10-2-6(5)11(8(10)14)18-19(15,16)17;/h1,4,6,12H,2-3H2,(H2,9,13)(H,15,16,17);/q;+1/p-1/t4-,6+;/m0./s1 |
| InChIKey | QAMLQLFGLXSQKM-SCBRTWSOSA-M |
| XLogP | -5.73 |
| TPSA | 153.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.24 |
| LogP ≤ 5 | -5.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|