C17H15N4NaO6S — CID 172778910
sodium [(1R,8R)-10-oxo-8-(pyridin-4-ylmethylcarbamoyl)-9,11-diazatricyclo[7.2.1.02,7]dodeca-2,4,6-trien-11-yl] sulfate (PubChem CID 172778910) has the molecular formula C17H15N4NaO6S and a molecular weight of 426.39 g/mol. Its IUPAC name is sodium [(1R,8R)-10-oxo-8-(pyridin-4-ylmethylcarbamoyl)-9,11-diazatricyclo[7.2.1.02,7]dodeca-2,4,6-trien-11-yl] sulfate.
| Compound Name | sodium [(1R,8R)-10-oxo-8-(pyridin-4-ylmethylcarbamoyl)-9,11-diazatricyclo[7.2.1.02,7]dodeca-2,4,6-trien-11-yl] sulfate |
|---|---|
| PubChem CID | 172778910 |
| Molecular Formula | C17H15N4NaO6S |
| Molecular Weight | 426.39 g/mol |
| Exact Mass | 426.06 |
| IUPAC Name | sodium [(1R,8R)-10-oxo-8-(pyridin-4-ylmethylcarbamoyl)-9,11-diazatricyclo[7.2.1.02,7]dodeca-2,4,6-trien-11-yl] sulfate |
| SMILES | O=C(NCc1ccncc1)[C@H]1c2ccccc2[C@@H]2CN1C(=O)N2OS(=O)(=O)[O-].[Na+] |
| InChI | InChI=1S/C17H16N4O6S.Na/c22-16(19-9-11-5-7-18-8-6-11)15-13-4-2-1-3-12(13)14-10-20(15)17(23)21(14)27-28(24,25)26;/h1-8,14-15H,9-10H2,(H,19,22)(H,24,25,26);/q;+1/p-1/t14-,15+;/m0./s1 |
| InChIKey | NZHNOZFZNGFWDF-LDXVYITESA-M |
| XLogP | -2.37 |
| TPSA | 131.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.39 |
| LogP ≤ 5 | -2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|