C18H24N6O10S — CID 142767167
bis[2-carbamoyl-4-(methoxymethyl)-7-oxo-1,6-diazabicyclo[3.2.1]oct-3-en-6-yl] sulfate (PubChem CID 142767167) has the molecular formula C18H24N6O10S and a molecular weight of 516.49 g/mol. Its IUPAC name is bis[2-carbamoyl-4-(methoxymethyl)-7-oxo-1,6-diazabicyclo[3.2.1]oct-3-en-6-yl] sulfate.
| Compound Name | bis[2-carbamoyl-4-(methoxymethyl)-7-oxo-1,6-diazabicyclo[3.2.1]oct-3-en-6-yl] sulfate |
|---|---|
| PubChem CID | 142767167 |
| Molecular Formula | C18H24N6O10S |
| Molecular Weight | 516.49 g/mol |
| Exact Mass | 516.13 |
| IUPAC Name | bis[2-carbamoyl-4-(methoxymethyl)-7-oxo-1,6-diazabicyclo[3.2.1]oct-3-en-6-yl] sulfate |
| SMILES | COCC1=CC(C(N)=O)N2CC1N(OS(=O)(=O)ON1C(=O)N3CC1C(COC)=CC3C(N)=O)C2=O |
| InChI | InChI=1S/C18H24N6O10S/c1-31-7-9-3-11(15(19)25)21-5-13(9)23(17(21)27)33-35(29,30)34-24-14-6-22(18(24)28)12(16(20)26)4-10(14)8-32-2/h3-4,11-14H,5-8H2,1-2H3,(H2,19,25)(H2,20,26) |
| InChIKey | CHUBOROWWFBINQ-UHFFFAOYSA-N |
| XLogP | -2.81 |
| TPSA | 204.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.49 |
| LogP ≤ 5 | -2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|