C9H12N3NaO6S — CID 71765689
sodium [(2S,5S)-2-carbamoyl-3-ethyl-7-oxo-1,6-diazabicyclo[3.2.1]oct-3-en-6-yl] sulfate (PubChem CID 71765689) has the molecular formula C9H12N3NaO6S and a molecular weight of 313.27 g/mol. Its IUPAC name is sodium [(2S,5S)-2-carbamoyl-3-ethyl-7-oxo-1,6-diazabicyclo[3.2.1]oct-3-en-6-yl] sulfate.
| Compound Name | sodium [(2S,5S)-2-carbamoyl-3-ethyl-7-oxo-1,6-diazabicyclo[3.2.1]oct-3-en-6-yl] sulfate |
|---|---|
| PubChem CID | 71765689 |
| Molecular Formula | C9H12N3NaO6S |
| Molecular Weight | 313.27 g/mol |
| Exact Mass | 313.03 |
| IUPAC Name | sodium [(2S,5S)-2-carbamoyl-3-ethyl-7-oxo-1,6-diazabicyclo[3.2.1]oct-3-en-6-yl] sulfate |
| SMILES | CCC1=C[C@H]2CN(C(=O)N2OS(=O)(=O)[O-])[C@@H]1C(N)=O.[Na+] |
| InChI | InChI=1S/C9H13N3O6S.Na/c1-2-5-3-6-4-11(7(5)8(10)13)9(14)12(6)18-19(15,16)17;/h3,6-7H,2,4H2,1H3,(H2,10,13)(H,15,16,17);/q;+1/p-1/t6-,7-;/m0./s1 |
| InChIKey | DFWKYRVUOSPTSQ-LEUCUCNGSA-M |
| XLogP | -4.31 |
| TPSA | 133.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.27 |
| LogP ≤ 5 | -4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|