C10H15N4NaO8S2 — CID 172692950
sodium [(2S,5R)-3-methyl-7-oxo-2-(2-sulfamoylethylcarbamoyl)-1,6-diazabicyclo[3.2.1]oct-3-en-6-yl] sulfate (PubChem CID 172692950) has the molecular formula C10H15N4NaO8S2 and a molecular weight of 406.37 g/mol. Its IUPAC name is sodium [(2S,5R)-3-methyl-7-oxo-2-(2-sulfamoylethylcarbamoyl)-1,6-diazabicyclo[3.2.1]oct-3-en-6-yl] sulfate.
| Compound Name | sodium [(2S,5R)-3-methyl-7-oxo-2-(2-sulfamoylethylcarbamoyl)-1,6-diazabicyclo[3.2.1]oct-3-en-6-yl] sulfate |
|---|---|
| PubChem CID | 172692950 |
| Molecular Formula | C10H15N4NaO8S2 |
| Molecular Weight | 406.37 g/mol |
| Exact Mass | 406.02 |
| IUPAC Name | sodium [(2S,5R)-3-methyl-7-oxo-2-(2-sulfamoylethylcarbamoyl)-1,6-diazabicyclo[3.2.1]oct-3-en-6-yl] sulfate |
| SMILES | CC1=C[C@@H]2CN(C(=O)N2OS(=O)(=O)[O-])[C@@H]1C(=O)NCCS(N)(=O)=O.[Na+] |
| InChI | InChI=1S/C10H16N4O8S2.Na/c1-6-4-7-5-13(10(16)14(7)22-24(19,20)21)8(6)9(15)12-2-3-23(11,17)18;/h4,7-8H,2-3,5H2,1H3,(H,12,15)(H2,11,17,18)(H,19,20,21);/q;+1/p-1/t7-,8+;/m1./s1 |
| InChIKey | BXUOZLOZUXZHBJ-WLYNEOFISA-M |
| XLogP | -5.78 |
| TPSA | 179.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.37 |
| LogP ≤ 5 | -5.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|