C15H23FN4O7S — CID 161090030
ethyl (2R)-2-fluoro-2-[[(2S,5R)-3-methyl-7-oxo-2-(3-sulfamoylpropylcarbamoyl)-1,6-diazabicyclo[3.2.1]oct-3-en-6-yl]oxy]acetate (PubChem CID 161090030) has the molecular formula C15H23FN4O7S and a molecular weight of 422.44 g/mol. Its IUPAC name is ethyl (2R)-2-fluoro-2-[[(2S,5R)-3-methyl-7-oxo-2-(3-sulfamoylpropylcarbamoyl)-1,6-diazabicyclo[3.2.1]oct-3-en-6-yl]oxy]acetate.
| Compound Name | ethyl (2R)-2-fluoro-2-[[(2S,5R)-3-methyl-7-oxo-2-(3-sulfamoylpropylcarbamoyl)-1,6-diazabicyclo[3.2.1]oct-3-en-6-yl]oxy]acetate |
|---|---|
| PubChem CID | 161090030 |
| Molecular Formula | C15H23FN4O7S |
| Molecular Weight | 422.44 g/mol |
| Exact Mass | 422.13 |
| IUPAC Name | ethyl (2R)-2-fluoro-2-[[(2S,5R)-3-methyl-7-oxo-2-(3-sulfamoylpropylcarbamoyl)-1,6-diazabicyclo[3.2.1]oct-3-en-6-yl]oxy]acetate |
| SMILES | CCOC(=O)[C@@H](F)ON1C(=O)N2C[C@H]1C=C(C)[C@H]2C(=O)NCCCS(N)(=O)=O |
| InChI | InChI=1S/C15H23FN4O7S/c1-3-26-14(22)12(16)27-20-10-7-9(2)11(19(8-10)15(20)23)13(21)18-5-4-6-28(17,24)25/h7,10-12H,3-6,8H2,1-2H3,(H,18,21)(H2,17,24,25)/t10-,11+,12+/m1/s1 |
| InChIKey | UHAWFODXTRWYJO-WOPDTQHZSA-N |
| XLogP | -0.99 |
| TPSA | 148.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.44 |
| LogP ≤ 5 | -0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|