C18H29FN4O7S — CID 162644143
hexyl (2S)-2-fluoro-2-[[(2S,5R)-3-methyl-7-oxo-2-(2-sulfamoylethylcarbamoyl)-1,6-diazabicyclo[3.2.1]oct-3-en-6-yl]oxy]acetate (PubChem CID 162644143) has the molecular formula C18H29FN4O7S and a molecular weight of 464.52 g/mol. Its IUPAC name is hexyl (2S)-2-fluoro-2-[[(2S,5R)-3-methyl-7-oxo-2-(2-sulfamoylethylcarbamoyl)-1,6-diazabicyclo[3.2.1]oct-3-en-6-yl]oxy]acetate.
| Compound Name | hexyl (2S)-2-fluoro-2-[[(2S,5R)-3-methyl-7-oxo-2-(2-sulfamoylethylcarbamoyl)-1,6-diazabicyclo[3.2.1]oct-3-en-6-yl]oxy]acetate |
|---|---|
| PubChem CID | 162644143 |
| Molecular Formula | C18H29FN4O7S |
| Molecular Weight | 464.52 g/mol |
| Exact Mass | 464.17 |
| IUPAC Name | hexyl (2S)-2-fluoro-2-[[(2S,5R)-3-methyl-7-oxo-2-(2-sulfamoylethylcarbamoyl)-1,6-diazabicyclo[3.2.1]oct-3-en-6-yl]oxy]acetate |
| SMILES | CCCCCCOC(=O)[C@H](F)ON1C(=O)N2C[C@H]1C=C(C)[C@H]2C(=O)NCCS(N)(=O)=O |
| InChI | InChI=1S/C18H29FN4O7S/c1-3-4-5-6-8-29-17(25)15(19)30-23-13-10-12(2)14(22(11-13)18(23)26)16(24)21-7-9-31(20,27)28/h10,13-15H,3-9,11H2,1-2H3,(H,21,24)(H2,20,27,28)/t13-,14+,15-/m1/s1 |
| InChIKey | GLLBUGMHBMTQTL-QLFBSQMISA-N |
| XLogP | 0.18 |
| TPSA | 148.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.52 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|