C12H15F2N3O6S — CID 172807597
[(2S,5R)-2-[(3,3-difluorocyclobutyl)carbamoyl]-3-methyl-7-oxo-1,6-diazabicyclo[3.2.1]oct-3-en-6-yl] hydrogen sulfate (PubChem CID 172807597) has the molecular formula C12H15F2N3O6S and a molecular weight of 367.33 g/mol. Its IUPAC name is [(2S,5R)-2-[(3,3-difluorocyclobutyl)carbamoyl]-3-methyl-7-oxo-1,6-diazabicyclo[3.2.1]oct-3-en-6-yl] hydrogen sulfate.
| Compound Name | [(2S,5R)-2-[(3,3-difluorocyclobutyl)carbamoyl]-3-methyl-7-oxo-1,6-diazabicyclo[3.2.1]oct-3-en-6-yl] hydrogen sulfate |
|---|---|
| PubChem CID | 172807597 |
| Molecular Formula | C12H15F2N3O6S |
| Molecular Weight | 367.33 g/mol |
| Exact Mass | 367.06 |
| IUPAC Name | [(2S,5R)-2-[(3,3-difluorocyclobutyl)carbamoyl]-3-methyl-7-oxo-1,6-diazabicyclo[3.2.1]oct-3-en-6-yl] hydrogen sulfate |
| SMILES | CC1=C[C@@H]2CN(C(=O)N2OS(=O)(=O)O)[C@@H]1C(=O)NC1CC(F)(F)C1 |
| InChI | InChI=1S/C12H15F2N3O6S/c1-6-2-8-5-16(11(19)17(8)23-24(20,21)22)9(6)10(18)15-7-3-12(13,14)4-7/h2,7-9H,3-5H2,1H3,(H,15,18)(H,20,21,22)/t8-,9+/m1/s1 |
| InChIKey | BLQGMTQWQGVTGQ-BDAKNGLRSA-N |
| XLogP | 0.07 |
| TPSA | 116.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.33 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|