C13H20N4O7S — CID 150771071
[(2S,5R)-3-methyl-7-oxo-2-[[(2S)-pyrrolidin-2-yl]methoxycarbamoyl]-1,6-diazabicyclo[3.2.1]oct-3-en-6-yl] hydrogen sulfate (PubChem CID 150771071) has the molecular formula C13H20N4O7S and a molecular weight of 376.39 g/mol. Its IUPAC name is [(2S,5R)-3-methyl-7-oxo-2-[[(2S)-pyrrolidin-2-yl]methoxycarbamoyl]-1,6-diazabicyclo[3.2.1]oct-3-en-6-yl] hydrogen sulfate.
| Compound Name | [(2S,5R)-3-methyl-7-oxo-2-[[(2S)-pyrrolidin-2-yl]methoxycarbamoyl]-1,6-diazabicyclo[3.2.1]oct-3-en-6-yl] hydrogen sulfate |
|---|---|
| PubChem CID | 150771071 |
| Molecular Formula | C13H20N4O7S |
| Molecular Weight | 376.39 g/mol |
| Exact Mass | 376.11 |
| IUPAC Name | [(2S,5R)-3-methyl-7-oxo-2-[[(2S)-pyrrolidin-2-yl]methoxycarbamoyl]-1,6-diazabicyclo[3.2.1]oct-3-en-6-yl] hydrogen sulfate |
| SMILES | CC1=C[C@@H]2CN(C(=O)N2OS(=O)(=O)O)[C@@H]1C(=O)NOC[C@@H]1CCCN1 |
| InChI | InChI=1S/C13H20N4O7S/c1-8-5-10-6-16(13(19)17(10)24-25(20,21)22)11(8)12(18)15-23-7-9-3-2-4-14-9/h5,9-11,14H,2-4,6-7H2,1H3,(H,15,18)(H,20,21,22)/t9-,10+,11-/m0/s1 |
| InChIKey | JZWKHINFKKAZJH-AXFHLTTASA-N |
| XLogP | -1.04 |
| TPSA | 137.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.39 |
| LogP ≤ 5 | -1.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|