C17H22N4O7S — CID 123412641
[10-oxo-8-(piperidin-2-ylmethoxycarbamoyl)-9,11-diazatricyclo[7.2.1.02,7]dodeca-2,4,6-trien-11-yl] hydrogen sulfate (PubChem CID 123412641) has the molecular formula C17H22N4O7S and a molecular weight of 426.45 g/mol. Its IUPAC name is [10-oxo-8-(piperidin-2-ylmethoxycarbamoyl)-9,11-diazatricyclo[7.2.1.02,7]dodeca-2,4,6-trien-11-yl] hydrogen sulfate.
| Compound Name | [10-oxo-8-(piperidin-2-ylmethoxycarbamoyl)-9,11-diazatricyclo[7.2.1.02,7]dodeca-2,4,6-trien-11-yl] hydrogen sulfate |
|---|---|
| PubChem CID | 123412641 |
| Molecular Formula | C17H22N4O7S |
| Molecular Weight | 426.45 g/mol |
| Exact Mass | 426.12 |
| IUPAC Name | [10-oxo-8-(piperidin-2-ylmethoxycarbamoyl)-9,11-diazatricyclo[7.2.1.02,7]dodeca-2,4,6-trien-11-yl] hydrogen sulfate |
| SMILES | O=C(NOCC1CCCCN1)C1c2ccccc2C2CN1C(=O)N2OS(=O)(=O)O |
| InChI | InChI=1S/C17H22N4O7S/c22-16(19-27-10-11-5-3-4-8-18-11)15-13-7-2-1-6-12(13)14-9-20(15)17(23)21(14)28-29(24,25)26/h1-2,6-7,11,14-15,18H,3-5,8-10H2,(H,19,22)(H,24,25,26) |
| InChIKey | AVJVUDZRWRODEI-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 137.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.45 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|