C15H21N3O5 — CID 151729167
(2S,5R)-3-methyl-N-(oxetan-3-ylmethoxy)-7-oxo-6-prop-2-enoxy-1,6-diazabicyclo[3.2.1]oct-3-ene-2-carboxamide (PubChem CID 151729167) has the molecular formula C15H21N3O5 and a molecular weight of 323.35 g/mol. Its IUPAC name is (2S,5R)-3-methyl-N-(oxetan-3-ylmethoxy)-7-oxo-6-prop-2-enoxy-1,6-diazabicyclo[3.2.1]oct-3-ene-2-carboxamide.
| Compound Name | (2S,5R)-3-methyl-N-(oxetan-3-ylmethoxy)-7-oxo-6-prop-2-enoxy-1,6-diazabicyclo[3.2.1]oct-3-ene-2-carboxamide |
|---|---|
| PubChem CID | 151729167 |
| Molecular Formula | C15H21N3O5 |
| Molecular Weight | 323.35 g/mol |
| Exact Mass | 323.15 |
| IUPAC Name | (2S,5R)-3-methyl-N-(oxetan-3-ylmethoxy)-7-oxo-6-prop-2-enoxy-1,6-diazabicyclo[3.2.1]oct-3-ene-2-carboxamide |
| SMILES | C=CCON1C(=O)N2C[C@H]1C=C(C)[C@H]2C(=O)NOCC1COC1 |
| InChI | InChI=1S/C15H21N3O5/c1-3-4-23-18-12-5-10(2)13(17(6-12)15(18)20)14(19)16-22-9-11-7-21-8-11/h3,5,11-13H,1,4,6-9H2,2H3,(H,16,19)/t12-,13+/m1/s1 |
| InChIKey | RKEYCSKOQAGKRU-OLZOCXBDSA-N |
| XLogP | 0.23 |
| TPSA | 80.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.35 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|