C11H18N4O5S — CID 134352740
(2S,5R)-6-hydroxy-3-methyl-7-oxo-N-(3-sulfamoylpropyl)-1,6-diazabicyclo[3.2.1]oct-3-ene-2-carboxamide (PubChem CID 134352740) has the molecular formula C11H18N4O5S and a molecular weight of 318.36 g/mol. Its IUPAC name is (2S,5R)-6-hydroxy-3-methyl-7-oxo-N-(3-sulfamoylpropyl)-1,6-diazabicyclo[3.2.1]oct-3-ene-2-carboxamide.
| Compound Name | (2S,5R)-6-hydroxy-3-methyl-7-oxo-N-(3-sulfamoylpropyl)-1,6-diazabicyclo[3.2.1]oct-3-ene-2-carboxamide |
|---|---|
| PubChem CID | 134352740 |
| Molecular Formula | C11H18N4O5S |
| Molecular Weight | 318.36 g/mol |
| Exact Mass | 318.10 |
| IUPAC Name | (2S,5R)-6-hydroxy-3-methyl-7-oxo-N-(3-sulfamoylpropyl)-1,6-diazabicyclo[3.2.1]oct-3-ene-2-carboxamide |
| SMILES | CC1=C[C@@H]2CN(C(=O)N2O)[C@@H]1C(=O)NCCCS(N)(=O)=O |
| InChI | InChI=1S/C11H18N4O5S/c1-7-5-8-6-14(11(17)15(8)18)9(7)10(16)13-3-2-4-21(12,19)20/h5,8-9,18H,2-4,6H2,1H3,(H,13,16)(H2,12,19,20)/t8-,9+/m1/s1 |
| InChIKey | XXRFBEQLQLPSIW-BDAKNGLRSA-N |
| XLogP | -1.39 |
| TPSA | 133.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.36 |
| LogP ≤ 5 | -1.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|