C10H18N2O5S — CID 113361074
2-(3-sulfamoylpropylcarbamoyl)cyclopentane-1-carboxylic acid (PubChem CID 113361074) has the molecular formula C10H18N2O5S and a molecular weight of 278.33 g/mol. Its IUPAC name is 2-(3-sulfamoylpropylcarbamoyl)cyclopentane-1-carboxylic acid.
| Compound Name | 2-(3-sulfamoylpropylcarbamoyl)cyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 113361074 |
| Molecular Formula | C10H18N2O5S |
| Molecular Weight | 278.33 g/mol |
| Exact Mass | 278.09 |
| IUPAC Name | 2-(3-sulfamoylpropylcarbamoyl)cyclopentane-1-carboxylic acid |
| SMILES | NS(=O)(=O)CCCNC(=O)C1CCCC1C(=O)O |
| InChI | InChI=1S/C10H18N2O5S/c11-18(16,17)6-2-5-12-9(13)7-3-1-4-8(7)10(14)15/h7-8H,1-6H2,(H,12,13)(H,14,15)(H2,11,16,17) |
| InChIKey | IQULMCHWHPWZRE-UHFFFAOYSA-N |
| XLogP | -0.72 |
| TPSA | 126.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.33 |
| LogP ≤ 5 | -0.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|