C9H18N2O3S2 — CID 80596435
N-(3-sulfamoylpropyl)thiane-2-carboxamide (PubChem CID 80596435) has the molecular formula C9H18N2O3S2 and a molecular weight of 266.39 g/mol. Its IUPAC name is N-(3-sulfamoylpropyl)thiane-2-carboxamide.
| Compound Name | N-(3-sulfamoylpropyl)thiane-2-carboxamide |
|---|---|
| PubChem CID | 80596435 |
| Molecular Formula | C9H18N2O3S2 |
| Molecular Weight | 266.39 g/mol |
| Exact Mass | 266.08 |
| IUPAC Name | N-(3-sulfamoylpropyl)thiane-2-carboxamide |
| SMILES | NS(=O)(=O)CCCNC(=O)C1CCCCS1 |
| InChI | InChI=1S/C9H18N2O3S2/c10-16(13,14)7-3-5-11-9(12)8-4-1-2-6-15-8/h8H,1-7H2,(H,11,12)(H2,10,13,14) |
| InChIKey | YGTMLFJBZAZUAW-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.39 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|