C9H18N2O5S2 — CID 104521843
1,1-dioxo-N-(3-sulfamoylpropyl)thiane-2-carboxamide (PubChem CID 104521843) has the molecular formula C9H18N2O5S2 and a molecular weight of 298.39 g/mol. Its IUPAC name is 1,1-dioxo-N-(3-sulfamoylpropyl)thiane-2-carboxamide.
| Compound Name | 1,1-dioxo-N-(3-sulfamoylpropyl)thiane-2-carboxamide |
|---|---|
| PubChem CID | 104521843 |
| Molecular Formula | C9H18N2O5S2 |
| Molecular Weight | 298.39 g/mol |
| Exact Mass | 298.07 |
| IUPAC Name | 1,1-dioxo-N-(3-sulfamoylpropyl)thiane-2-carboxamide |
| SMILES | NS(=O)(=O)CCCNC(=O)C1CCCCS1(=O)=O |
| InChI | InChI=1S/C9H18N2O5S2/c10-18(15,16)7-3-5-11-9(12)8-4-1-2-6-17(8,13)14/h8H,1-7H2,(H,11,12)(H2,10,15,16) |
| InChIKey | CVFZEHJWEPZMSA-UHFFFAOYSA-N |
| XLogP | -1.25 |
| TPSA | 123.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.39 |
| LogP ≤ 5 | -1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|