C8H15N3O4S — CID 104521751
N-(2-amino-2-hydroxyiminoethyl)-1,1-dioxothiane-2-carboxamide (PubChem CID 104521751) has the molecular formula C8H15N3O4S and a molecular weight of 249.29 g/mol. Its IUPAC name is N-(2-amino-2-hydroxyiminoethyl)-1,1-dioxothiane-2-carboxamide.
| Compound Name | N-(2-amino-2-hydroxyiminoethyl)-1,1-dioxothiane-2-carboxamide |
|---|---|
| PubChem CID | 104521751 |
| Molecular Formula | C8H15N3O4S |
| Molecular Weight | 249.29 g/mol |
| Exact Mass | 249.08 |
| IUPAC Name | N-(2-amino-2-hydroxyiminoethyl)-1,1-dioxothiane-2-carboxamide |
| SMILES | NC(CNC(=O)C1CCCCS1(=O)=O)=NO |
| InChI | InChI=1S/C8H15N3O4S/c9-7(11-13)5-10-8(12)6-3-1-2-4-16(6,14)15/h6,13H,1-5H2,(H2,9,11)(H,10,12) |
| InChIKey | ZIIMBPZSAVTQSC-UHFFFAOYSA-N |
| XLogP | -1.18 |
| TPSA | 121.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.29 |
| LogP ≤ 5 | -1.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|