C10H16F3N3O2 — CID 104622537
N-(2-amino-2-hydroxyiminoethyl)-2-(trifluoromethyl)cyclohexane-1-carboxamide (PubChem CID 104622537) has the molecular formula C10H16F3N3O2 and a molecular weight of 267.25 g/mol. Its IUPAC name is N-(2-amino-2-hydroxyiminoethyl)-2-(trifluoromethyl)cyclohexane-1-carboxamide.
| Compound Name | N-(2-amino-2-hydroxyiminoethyl)-2-(trifluoromethyl)cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 104622537 |
| Molecular Formula | C10H16F3N3O2 |
| Molecular Weight | 267.25 g/mol |
| Exact Mass | 267.12 |
| IUPAC Name | N-(2-amino-2-hydroxyiminoethyl)-2-(trifluoromethyl)cyclohexane-1-carboxamide |
| SMILES | NC(CNC(=O)C1CCCCC1C(F)(F)F)=NO |
| InChI | InChI=1S/C10H16F3N3O2/c11-10(12,13)7-4-2-1-3-6(7)9(17)15-5-8(14)16-18/h6-7,18H,1-5H2,(H2,14,16)(H,15,17) |
| InChIKey | ZLBSOUHLEBWPHG-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 87.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.25 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|