C13H20F3NO — CID 113224088
N-cyclopentyl-2-(trifluoromethyl)cyclohexane-1-carboxamide (PubChem CID 113224088) has the molecular formula C13H20F3NO and a molecular weight of 263.30 g/mol. Its IUPAC name is N-cyclopentyl-2-(trifluoromethyl)cyclohexane-1-carboxamide.
| Compound Name | N-cyclopentyl-2-(trifluoromethyl)cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 113224088 |
| Molecular Formula | C13H20F3NO |
| Molecular Weight | 263.30 g/mol |
| Exact Mass | 263.15 |
| IUPAC Name | N-cyclopentyl-2-(trifluoromethyl)cyclohexane-1-carboxamide |
| SMILES | O=C(NC1CCCC1)C1CCCCC1C(F)(F)F |
| InChI | InChI=1S/C13H20F3NO/c14-13(15,16)11-8-4-3-7-10(11)12(18)17-9-5-1-2-6-9/h9-11H,1-8H2,(H,17,18) |
| InChIKey | IFROQEDYDHVHSC-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.30 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |