About cis-methyl (1S,2R)-2-(trifluoromethyl)cyclohexane-1-carboxylate
cis-methyl (1S,2R)-2-(trifluoromethyl)cyclohexane-1-carboxylate (PubChem CID 129381648) has the molecular formula C9H13F3O2
and a molecular weight of 210.19 g/mol. Its IUPAC name is cis-methyl (1S,2R)-2-(trifluoromethyl)cyclohexane-1-carboxylate.
Analyze cis-methyl (1S,2R)-2-(trifluoromethyl)cyclohexane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cis-methyl (1S,2R)-2-(trifluoromethyl)cyclohexane-1-carboxylate?
The IUPAC name of cis-methyl (1S,2R)-2-(trifluoromethyl)cyclohexane-1-carboxylate (CID 129381648) is cis-methyl (1S,2R)-2-(trifluoromethyl)cyclohexane-1-carboxylate.
What is the SMILES notation for cis-methyl (1S,2R)-2-(trifluoromethyl)cyclohexane-1-carboxylate?
The canonical SMILES for cis-methyl (1S,2R)-2-(trifluoromethyl)cyclohexane-1-carboxylate is COC(=O)[C@H]1CCCC[C@H]1C(F)(F)F.
What is the InChIKey of cis-methyl (1S,2R)-2-(trifluoromethyl)cyclohexane-1-carboxylate?
The InChIKey is LWSZWWSRHDIBHR-NKWVEPMBSA-N. The full InChI is InChI=1S/C9H13F3O2/c1-14-8(13)6-4-2-3-5-7(6)9(10,11)12/h6-7H,2-5H2,1H3/t6-,7+/m0/s1.
What are the key properties of cis-methyl (1S,2R)-2-(trifluoromethyl)cyclohexane-1-carboxylate?
cis-methyl (1S,2R)-2-(trifluoromethyl)cyclohexane-1-carboxylate has a molecular weight of 210.19 g/mol, XLogP of 2.53, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cis-methyl (1S,2R)-2-(trifluoromethyl)cyclohexane-1-carboxylate is sourced from PubChem (CID 129381648), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).