C14H21F3N2O4 — CID 71887796
[2-(2-acetamidoethylamino)-2-oxoethyl] 2-(trifluoromethyl)cyclohexane-1-carboxylate (PubChem CID 71887796) has the molecular formula C14H21F3N2O4 and a molecular weight of 338.33 g/mol. Its IUPAC name is [2-(2-acetamidoethylamino)-2-oxoethyl] 2-(trifluoromethyl)cyclohexane-1-carboxylate.
| Compound Name | [2-(2-acetamidoethylamino)-2-oxoethyl] 2-(trifluoromethyl)cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 71887796 |
| Molecular Formula | C14H21F3N2O4 |
| Molecular Weight | 338.33 g/mol |
| Exact Mass | 338.15 |
| IUPAC Name | [2-(2-acetamidoethylamino)-2-oxoethyl] 2-(trifluoromethyl)cyclohexane-1-carboxylate |
| SMILES | CC(=O)NCCNC(=O)COC(=O)C1CCCCC1C(F)(F)F |
| InChI | InChI=1S/C14H21F3N2O4/c1-9(20)18-6-7-19-12(21)8-23-13(22)10-4-2-3-5-11(10)14(15,16)17/h10-11H,2-8H2,1H3,(H,18,20)(H,19,21) |
| InChIKey | HJDKFHPAVQCSNZ-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.33 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|