C12H20N2O4 — CID 42302869
cis-(1S,2R)-2-(2-acetamidoethylcarbamoyl)cyclohexane-1-carboxylic acid (PubChem CID 42302869) has the molecular formula C12H20N2O4 and a molecular weight of 256.30 g/mol. Its IUPAC name is cis-(1S,2R)-2-(2-acetamidoethylcarbamoyl)cyclohexane-1-carboxylic acid.
| Compound Name | cis-(1S,2R)-2-(2-acetamidoethylcarbamoyl)cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 42302869 |
| Molecular Formula | C12H20N2O4 |
| Molecular Weight | 256.30 g/mol |
| Exact Mass | 256.14 |
| IUPAC Name | cis-(1S,2R)-2-(2-acetamidoethylcarbamoyl)cyclohexane-1-carboxylic acid |
| SMILES | CC(=O)NCCNC(=O)[C@@H]1CCCC[C@@H]1C(=O)O |
| InChI | InChI=1S/C12H20N2O4/c1-8(15)13-6-7-14-11(16)9-4-2-3-5-10(9)12(17)18/h9-10H,2-7H2,1H3,(H,13,15)(H,14,16)(H,17,18)/t9-,10+/m1/s1 |
| InChIKey | BICMXZBAAQQHOB-ZJUUUORDSA-N |
| XLogP | 0.13 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.30 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|