C11H16N2O3 — CID 93317766
cis-(1S,2R)-2-(2-cyanoethylcarbamoyl)cyclohexane-1-carboxylic acid (PubChem CID 93317766) has the molecular formula C11H16N2O3 and a molecular weight of 224.26 g/mol. Its IUPAC name is cis-(1S,2R)-2-(2-cyanoethylcarbamoyl)cyclohexane-1-carboxylic acid.
| Compound Name | cis-(1S,2R)-2-(2-cyanoethylcarbamoyl)cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 93317766 |
| Molecular Formula | C11H16N2O3 |
| Molecular Weight | 224.26 g/mol |
| Exact Mass | 224.12 |
| IUPAC Name | cis-(1S,2R)-2-(2-cyanoethylcarbamoyl)cyclohexane-1-carboxylic acid |
| SMILES | N#CCCNC(=O)[C@@H]1CCCC[C@@H]1C(=O)O |
| InChI | InChI=1S/C11H16N2O3/c12-6-3-7-13-10(14)8-4-1-2-5-9(8)11(15)16/h8-9H,1-5,7H2,(H,13,14)(H,15,16)/t8-,9+/m1/s1 |
| InChIKey | XZRJLGZGMNLNTI-BDAKNGLRSA-N |
| XLogP | 0.91 |
| TPSA | 90.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.26 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|