C14H22F3NO3 — CID 104622523
methyl 3-methyl-2-[[2-(trifluoromethyl)cyclohexanecarbonyl]amino]butanoate (PubChem CID 104622523) has the molecular formula C14H22F3NO3 and a molecular weight of 309.33 g/mol. Its IUPAC name is methyl 3-methyl-2-[[2-(trifluoromethyl)cyclohexanecarbonyl]amino]butanoate.
| Compound Name | methyl 3-methyl-2-[[2-(trifluoromethyl)cyclohexanecarbonyl]amino]butanoate |
|---|---|
| PubChem CID | 104622523 |
| Molecular Formula | C14H22F3NO3 |
| Molecular Weight | 309.33 g/mol |
| Exact Mass | 309.16 |
| IUPAC Name | methyl 3-methyl-2-[[2-(trifluoromethyl)cyclohexanecarbonyl]amino]butanoate |
| SMILES | COC(=O)C(NC(=O)C1CCCCC1C(F)(F)F)C(C)C |
| InChI | InChI=1S/C14H22F3NO3/c1-8(2)11(13(20)21-3)18-12(19)9-6-4-5-7-10(9)14(15,16)17/h8-11H,4-7H2,1-3H3,(H,18,19) |
| InChIKey | FENRSTITEDKKHO-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.33 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |