C12H18F3NO3 — CID 112700765
2-[[2-(trifluoromethyl)cyclohexanecarbonyl]amino]butanoic acid (PubChem CID 112700765) has the molecular formula C12H18F3NO3 and a molecular weight of 281.27 g/mol. Its IUPAC name is 2-[[2-(trifluoromethyl)cyclohexanecarbonyl]amino]butanoic acid.
| Compound Name | 2-[[2-(trifluoromethyl)cyclohexanecarbonyl]amino]butanoic acid |
|---|---|
| PubChem CID | 112700765 |
| Molecular Formula | C12H18F3NO3 |
| Molecular Weight | 281.27 g/mol |
| Exact Mass | 281.12 |
| IUPAC Name | 2-[[2-(trifluoromethyl)cyclohexanecarbonyl]amino]butanoic acid |
| SMILES | CCC(NC(=O)C1CCCCC1C(F)(F)F)C(=O)O |
| InChI | InChI=1S/C12H18F3NO3/c1-2-9(11(18)19)16-10(17)7-5-3-4-6-8(7)12(13,14)15/h7-9H,2-6H2,1H3,(H,16,17)(H,18,19) |
| InChIKey | QSWFOYZCVOYVNL-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.27 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |