C13H20F3NO3 — CID 107564252
(2S)-2-[[2-(trifluoromethyl)cyclohexanecarbonyl]amino]pentanoic acid (PubChem CID 107564252) has the molecular formula C13H20F3NO3 and a molecular weight of 295.30 g/mol. Its IUPAC name is (2S)-2-[[2-(trifluoromethyl)cyclohexanecarbonyl]amino]pentanoic acid.
| Compound Name | (2S)-2-[[2-(trifluoromethyl)cyclohexanecarbonyl]amino]pentanoic acid |
|---|---|
| PubChem CID | 107564252 |
| Molecular Formula | C13H20F3NO3 |
| Molecular Weight | 295.30 g/mol |
| Exact Mass | 295.14 |
| IUPAC Name | (2S)-2-[[2-(trifluoromethyl)cyclohexanecarbonyl]amino]pentanoic acid |
| SMILES | CCC[C@H](NC(=O)C1CCCCC1C(F)(F)F)C(=O)O |
| InChI | InChI=1S/C13H20F3NO3/c1-2-5-10(12(19)20)17-11(18)8-6-3-4-7-9(8)13(14,15)16/h8-10H,2-7H2,1H3,(H,17,18)(H,19,20)/t8?,9?,10-/m0/s1 |
| InChIKey | WSKVUWBUGSZXJE-RTBKNWGFSA-N |
| XLogP | 2.72 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.30 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |