C13H20F3NO3S — CID 104621967
(2S)-4-methylsulfanyl-2-[[2-(trifluoromethyl)cyclohexanecarbonyl]amino]butanoic acid (PubChem CID 104621967) has the molecular formula C13H20F3NO3S and a molecular weight of 327.37 g/mol. Its IUPAC name is (2S)-4-methylsulfanyl-2-[[2-(trifluoromethyl)cyclohexanecarbonyl]amino]butanoic acid.
| Compound Name | (2S)-4-methylsulfanyl-2-[[2-(trifluoromethyl)cyclohexanecarbonyl]amino]butanoic acid |
|---|---|
| PubChem CID | 104621967 |
| Molecular Formula | C13H20F3NO3S |
| Molecular Weight | 327.37 g/mol |
| Exact Mass | 327.11 |
| IUPAC Name | (2S)-4-methylsulfanyl-2-[[2-(trifluoromethyl)cyclohexanecarbonyl]amino]butanoic acid |
| SMILES | CSCC[C@H](NC(=O)C1CCCCC1C(F)(F)F)C(=O)O |
| InChI | InChI=1S/C13H20F3NO3S/c1-21-7-6-10(12(19)20)17-11(18)8-4-2-3-5-9(8)13(14,15)16/h8-10H,2-7H2,1H3,(H,17,18)(H,19,20)/t8?,9?,10-/m0/s1 |
| InChIKey | CXGFUXDHJWZUGC-RTBKNWGFSA-N |
| XLogP | 2.68 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.37 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |