C13H24N2O3S — CID 104909206
(2R)-2-[(2-aminocycloheptanecarbonyl)amino]-4-methylsulfanylbutanoic acid (PubChem CID 104909206) has the molecular formula C13H24N2O3S and a molecular weight of 288.41 g/mol. Its IUPAC name is (2R)-2-[(2-aminocycloheptanecarbonyl)amino]-4-methylsulfanylbutanoic acid.
| Compound Name | (2R)-2-[(2-aminocycloheptanecarbonyl)amino]-4-methylsulfanylbutanoic acid |
|---|---|
| PubChem CID | 104909206 |
| Molecular Formula | C13H24N2O3S |
| Molecular Weight | 288.41 g/mol |
| Exact Mass | 288.15 |
| IUPAC Name | (2R)-2-[(2-aminocycloheptanecarbonyl)amino]-4-methylsulfanylbutanoic acid |
| SMILES | CSCC[C@@H](NC(=O)C1CCCCCC1N)C(=O)O |
| InChI | InChI=1S/C13H24N2O3S/c1-19-8-7-11(13(17)18)15-12(16)9-5-3-2-4-6-10(9)14/h9-11H,2-8,14H2,1H3,(H,15,16)(H,17,18)/t9?,10?,11-/m1/s1 |
| InChIKey | AABZIHYSBHZWDI-VQXHTEKXSA-N |
| XLogP | 1.22 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.41 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |