C11H19NO3S2 — CID 104906428
(2R)-4-methylsulfanyl-2-(thiane-2-carbonylamino)butanoic acid (PubChem CID 104906428) has the molecular formula C11H19NO3S2 and a molecular weight of 277.41 g/mol. Its IUPAC name is (2R)-4-methylsulfanyl-2-(thiane-2-carbonylamino)butanoic acid.
| Compound Name | (2R)-4-methylsulfanyl-2-(thiane-2-carbonylamino)butanoic acid |
|---|---|
| PubChem CID | 104906428 |
| Molecular Formula | C11H19NO3S2 |
| Molecular Weight | 277.41 g/mol |
| Exact Mass | 277.08 |
| IUPAC Name | (2R)-4-methylsulfanyl-2-(thiane-2-carbonylamino)butanoic acid |
| SMILES | CSCC[C@@H](NC(=O)C1CCCCS1)C(=O)O |
| InChI | InChI=1S/C11H19NO3S2/c1-16-7-5-8(11(14)15)12-10(13)9-4-2-3-6-17-9/h8-9H,2-7H2,1H3,(H,12,13)(H,14,15)/t8-,9?/m1/s1 |
| InChIKey | YMBGYAIJCFFBDS-VEDVMXKPSA-N |
| XLogP | 1.59 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.41 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |