C16H27NO3S — CID 104906147
(2R)-2-(1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene-2-carbonylamino)-4-methylsulfanylbutanoic acid (PubChem CID 104906147) has the molecular formula C16H27NO3S and a molecular weight of 313.46 g/mol. Its IUPAC name is (2R)-2-(1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene-2-carbonylamino)-4-methylsulfanylbutanoic acid.
| Compound Name | (2R)-2-(1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene-2-carbonylamino)-4-methylsulfanylbutanoic acid |
|---|---|
| PubChem CID | 104906147 |
| Molecular Formula | C16H27NO3S |
| Molecular Weight | 313.46 g/mol |
| Exact Mass | 313.17 |
| IUPAC Name | (2R)-2-(1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene-2-carbonylamino)-4-methylsulfanylbutanoic acid |
| SMILES | CSCC[C@@H](NC(=O)C1CCC2CCCCC2C1)C(=O)O |
| InChI | InChI=1S/C16H27NO3S/c1-21-9-8-14(16(19)20)17-15(18)13-7-6-11-4-2-3-5-12(11)10-13/h11-14H,2-10H2,1H3,(H,17,18)(H,19,20)/t11?,12?,13?,14-/m1/s1 |
| InChIKey | WLAFEMIHWGBLRP-SLDMJWGPSA-N |
| XLogP | 2.92 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.46 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |