C19H33NO4 — CID 120533750
2-(1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene-2-carbonylamino)-4-[(2-methylpropan-2-yl)oxy]butanoic acid (PubChem CID 120533750) has the molecular formula C19H33NO4 and a molecular weight of 339.48 g/mol. Its IUPAC name is 2-(1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene-2-carbonylamino)-4-[(2-methylpropan-2-yl)oxy]butanoic acid.
| Compound Name | 2-(1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene-2-carbonylamino)-4-[(2-methylpropan-2-yl)oxy]butanoic acid |
|---|---|
| PubChem CID | 120533750 |
| Molecular Formula | C19H33NO4 |
| Molecular Weight | 339.48 g/mol |
| Exact Mass | 339.24 |
| IUPAC Name | 2-(1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene-2-carbonylamino)-4-[(2-methylpropan-2-yl)oxy]butanoic acid |
| SMILES | CC(C)(C)OCCC(NC(=O)C1CCC2CCCCC2C1)C(=O)O |
| InChI | InChI=1S/C19H33NO4/c1-19(2,3)24-11-10-16(18(22)23)20-17(21)15-9-8-13-6-4-5-7-14(13)12-15/h13-16H,4-12H2,1-3H3,(H,20,21)(H,22,23) |
| InChIKey | MSWRIDFGARVWAI-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.48 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |