C14H22F3NO3 — CID 104544073
2-[[2-(trifluoromethyl)cyclohexanecarbonyl]amino]hexanoic acid (PubChem CID 104544073) has the molecular formula C14H22F3NO3 and a molecular weight of 309.33 g/mol. Its IUPAC name is 2-[[2-(trifluoromethyl)cyclohexanecarbonyl]amino]hexanoic acid.
| Compound Name | 2-[[2-(trifluoromethyl)cyclohexanecarbonyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 104544073 |
| Molecular Formula | C14H22F3NO3 |
| Molecular Weight | 309.33 g/mol |
| Exact Mass | 309.16 |
| IUPAC Name | 2-[[2-(trifluoromethyl)cyclohexanecarbonyl]amino]hexanoic acid |
| SMILES | CCCCC(NC(=O)C1CCCCC1C(F)(F)F)C(=O)O |
| InChI | InChI=1S/C14H22F3NO3/c1-2-3-8-11(13(20)21)18-12(19)9-6-4-5-7-10(9)14(15,16)17/h9-11H,2-8H2,1H3,(H,18,19)(H,20,21) |
| InChIKey | QMCIHVVKAXXYEY-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.33 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |