C12H21NO4 — CID 79750914
2-[(2-methyloxolane-3-carbonyl)amino]hexanoic acid (PubChem CID 79750914) has the molecular formula C12H21NO4 and a molecular weight of 243.30 g/mol. Its IUPAC name is 2-[(2-methyloxolane-3-carbonyl)amino]hexanoic acid.
| Compound Name | 2-[(2-methyloxolane-3-carbonyl)amino]hexanoic acid |
|---|---|
| PubChem CID | 79750914 |
| Molecular Formula | C12H21NO4 |
| Molecular Weight | 243.30 g/mol |
| Exact Mass | 243.15 |
| IUPAC Name | 2-[(2-methyloxolane-3-carbonyl)amino]hexanoic acid |
| SMILES | CCCCC(NC(=O)C1CCOC1C)C(=O)O |
| InChI | InChI=1S/C12H21NO4/c1-3-4-5-10(12(15)16)13-11(14)9-6-7-17-8(9)2/h8-10H,3-7H2,1-2H3,(H,13,14)(H,15,16) |
| InChIKey | GDSDCBNBHDRGEY-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.30 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |