C13H22F3NO2S — CID 103799084
N-(4-hydroxy-3-methylsulfanylbutan-2-yl)-2-(trifluoromethyl)cyclohexane-1-carboxamide (PubChem CID 103799084) has the molecular formula C13H22F3NO2S and a molecular weight of 313.39 g/mol. Its IUPAC name is N-(4-hydroxy-3-methylsulfanylbutan-2-yl)-2-(trifluoromethyl)cyclohexane-1-carboxamide.
| Compound Name | N-(4-hydroxy-3-methylsulfanylbutan-2-yl)-2-(trifluoromethyl)cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 103799084 |
| Molecular Formula | C13H22F3NO2S |
| Molecular Weight | 313.39 g/mol |
| Exact Mass | 313.13 |
| IUPAC Name | N-(4-hydroxy-3-methylsulfanylbutan-2-yl)-2-(trifluoromethyl)cyclohexane-1-carboxamide |
| SMILES | CSC(CO)C(C)NC(=O)C1CCCCC1C(F)(F)F |
| InChI | InChI=1S/C13H22F3NO2S/c1-8(11(7-18)20-2)17-12(19)9-5-3-4-6-10(9)13(14,15)16/h8-11,18H,3-7H2,1-2H3,(H,17,19) |
| InChIKey | BWAAWZOLSRUVBF-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.39 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |